CAS 1021436-61-2 is the registry number for 5-(Chloromethyl)-3-(1-(4-chlorophenyl)cyclopropyl)-1,2,4-oxadiazole. Offered by: TRC. Available pack sizes: 100mg.
5-(chloromethyl)-3-[1-(4-chlorophenyl)cyclopropyl]-1,2,4-oxadiazole (CAS 1021436-61-2) is a chemical compound with the molecular formula C12H10Cl2N2O and a molecular weight of 269.12 g/mol. IUPAC name: 5-(chloromethyl)-3-[1-(4-chlorophenyl)cyclopropyl]-1,2,4-oxadiazole. InChIKey: NYJZGVZGPYKVGQ-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2O |
|---|---|
| Molecular weight | 269.12 g/mol |
| IUPAC name | 5-(chloromethyl)-3-[1-(4-chlorophenyl)cyclopropyl]-1,2,4-oxadiazole |
| InChIKey | NYJZGVZGPYKVGQ-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=C(C=C2)Cl)C3=NOC(=N3)CCl |
Computed by PubChem (NCBI)