CAS 173843-86-2 is the registry number for 4,5-Dichloro-2-(4-methylbenzyl)pyridazin-3(2H)-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dichloro-2-[(4-methylphenyl)methyl]pyridazin-3-one (CAS 173843-86-2) is a chemical compound with the molecular formula C12H10Cl2N2O and a molecular weight of 269.12 g/mol. IUPAC name: 4,5-dichloro-2-[(4-methylphenyl)methyl]pyridazin-3-one. InChIKey: YRIPMJIUOGUPRQ-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2O |
|---|---|
| Molecular weight | 269.12 g/mol |
| IUPAC name | 4,5-dichloro-2-[(4-methylphenyl)methyl]pyridazin-3-one |
| InChIKey | YRIPMJIUOGUPRQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN2C(=O)C(=C(C=N2)Cl)Cl |
Computed by PubChem (NCBI)