CAS 339009-11-9 is the registry number for 5-Amino-1-((3,4-dichlorophenyl)methyl)-1,2-dihydropyridin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-amino-1-[(3,4-dichlorophenyl)methyl]pyridin-2-one (CAS 339009-11-9) is a chemical compound with the molecular formula C12H10Cl2N2O and a molecular weight of 269.12 g/mol. IUPAC name: 5-amino-1-[(3,4-dichlorophenyl)methyl]pyridin-2-one. InChIKey: CHAJSJZVWTXBIU-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2O |
|---|---|
| Molecular weight | 269.12 g/mol |
| IUPAC name | 5-amino-1-[(3,4-dichlorophenyl)methyl]pyridin-2-one |
| InChIKey | CHAJSJZVWTXBIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN2C=C(C=CC2=O)N)Cl)Cl |
Computed by PubChem (NCBI)