Products 1414842-70-8
CAS 1414842-70-8 appears in our catalog under these names: VU0364770 hydrochloride, VU0364770 hydrochloride, VU0364770 (hydrochloride), 99.70%, 99.70%, VU0364770 (hydrochloride), 99.70%, VU0364770 (hydrochloride) (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 100mg, 25mg, 50mg, 5 mg, 50 mg.
N-(3-chlorophenyl)pyridine-2-carboxamide;hydrochloride (CAS 1414842-70-8) is a chemical compound with the molecular formula C12H10Cl2N2O and a molecular weight of 269.12 g/mol. IUPAC name: N-(3-chlorophenyl)pyridine-2-carboxamide;hydrochloride. InChIKey: CZNNJOSFWZBQKH-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2O |
|---|---|
| Molecular weight | 269.12 g/mol |
| IUPAC name | N-(3-chlorophenyl)pyridine-2-carboxamide;hydrochloride |
| InChIKey | CZNNJOSFWZBQKH-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)NC2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)