CAS 338783-99-6 is the registry number for 3-Amino-1-[(2,6-dichlorophenyl)methyl]-1,2-dihydropyridin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-amino-1-[(2,6-dichlorophenyl)methyl]pyridin-2-one (CAS 338783-99-6) is a chemical compound with the molecular formula C12H10Cl2N2O and a molecular weight of 269.12 g/mol. IUPAC name: 3-amino-1-[(2,6-dichlorophenyl)methyl]pyridin-2-one. InChIKey: AKFJARYQJOVTCN-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2O |
|---|---|
| Molecular weight | 269.12 g/mol |
| IUPAC name | 3-amino-1-[(2,6-dichlorophenyl)methyl]pyridin-2-one |
| InChIKey | AKFJARYQJOVTCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CN2C=CC=C(C2=O)N)Cl |
Computed by PubChem (NCBI)