CAS 1021450-82-7 is the registry number for Methyl 5-iodo-1-methyl-2-oxo-1,2-dihydropyridine-3-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 5-iodo-1-methyl-2-oxopyridine-3-carboxylate (CAS 1021450-82-7) is a chemical compound with the molecular formula C8H8INO3 and a molecular weight of 293.06 g/mol. IUPAC name: methyl 5-iodo-1-methyl-2-oxopyridine-3-carboxylate. InChIKey: ONYGULHBSKRMSX-UHFFFAOYSA-N.
| Molecular formula | C8H8INO3 |
|---|---|
| Molecular weight | 293.06 g/mol |
| IUPAC name | methyl 5-iodo-1-methyl-2-oxopyridine-3-carboxylate |
| InChIKey | ONYGULHBSKRMSX-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C(C1=O)C(=O)OC)I |
Computed by PubChem (NCBI)