CAS 102154-41-6 is the registry number for Acetic acid,2-[(2-phenylethenyl)sulfonyl]-, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 100mg.
2-[(E)-2-phenylethenyl]sulfonylacetic acid (CAS 102154-41-6) is a chemical compound with the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. IUPAC name: 2-[(E)-2-phenylethenyl]sulfonylacetic acid. InChIKey: WCOXFTGMNJJABC-VOTSOKGWSA-N.
| Molecular formula | C10H10O4S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 2-[(E)-2-phenylethenyl]sulfonylacetic acid |
| InChIKey | WCOXFTGMNJJABC-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/S(=O)(=O)CC(=O)O |
Computed by PubChem (NCBI)