Products 102185-35-3

CAS 102185-35-3 appears in our catalog under these names: Boc–DL–alpha–tert–butyl–Gly–OH, 2-((tert-Butoxycarbonyl)amino)-3,3-dimethylbutanoic acid, 98%(HPLC),RG, 98%(HPLC),RG. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 102185-35-3) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LRFZIPCTFBPFLX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H21NO4
Molecular weight231.29 g/mol
IUPAC name3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
InChIKeyLRFZIPCTFBPFLX-UHFFFAOYSA-N
SMILESCC(C)(C)C(C(=O)O)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)