Products 169870-82-0

CAS 169870-82-0 appears in our catalog under these names: Boc-dl-tle-oh, 97%, Boc-DL-Tle-OH 98%, Boc-DL-Tle-OH, 98%, 98%, N-Boc-t-butylglycine, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 169870-82-0) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LRFZIPCTFBPFLX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H21NO4
Molecular weight231.29 g/mol
IUPAC name3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
InChIKeyLRFZIPCTFBPFLX-UHFFFAOYSA-N
SMILESCC(C)(C)C(C(=O)O)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)