CAS 169870-82-0 appears in our catalog under these names: Boc-dl-tle-oh, 97%, Boc-DL-Tle-OH, 98%, 98%, N-Boc-t-butylglycine, 98%, Boc-DL-Tle-OH, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 10g, 1g, 100mg, 250mg.
3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 169870-82-0) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LRFZIPCTFBPFLX-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LRFZIPCTFBPFLX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)