CAS 1022151-32-1 appears in our catalog under these names: 6-Bromo-5-fluorobenzo(d)thiazol-2-amine, 95+%, 6-Bromo-5-fluoro-1,3-benzothiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,05g, 0,1g, 0,25g, 0,5g.
6-bromo-5-fluoro-1,3-benzothiazol-2-amine (CAS 1022151-32-1) is a chemical compound with the molecular formula C7H4BrFN2S and a molecular weight of 247.09 g/mol. IUPAC name: 6-bromo-5-fluoro-1,3-benzothiazol-2-amine. InChIKey: RTANGTWGWAJMPC-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2S |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 6-bromo-5-fluoro-1,3-benzothiazol-2-amine |
| InChIKey | RTANGTWGWAJMPC-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)Br)SC(=N2)N |
Computed by PubChem (NCBI)