Products 942473-90-7
CAS 942473-90-7 is the registry number for 7-Bromo-4-fluoro-1,3-benzothiazol-2-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
7-bromo-4-fluoro-1,3-benzothiazol-2-amine (CAS 942473-90-7) is a chemical compound with the molecular formula C7H4BrFN2S and a molecular weight of 247.09 g/mol. IUPAC name: 7-bromo-4-fluoro-1,3-benzothiazol-2-amine. InChIKey: LWIGNCTXUWWDDC-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2S |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 7-bromo-4-fluoro-1,3-benzothiazol-2-amine |
| InChIKey | LWIGNCTXUWWDDC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1F)N=C(S2)N)Br |
Computed by PubChem (NCBI)