CAS 2344868-64-8 is the registry number for 4-Bromo-5-fluoro-7-methylbenzo[c][1,2,5]thiadiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-5-fluoro-7-methyl-2,1,3-benzothiadiazole (CAS 2344868-64-8) is a chemical compound with the molecular formula C7H4BrFN2S and a molecular weight of 247.09 g/mol. IUPAC name: 4-bromo-5-fluoro-7-methyl-2,1,3-benzothiadiazole. InChIKey: AEURJERKGUIHQF-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2S |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 4-bromo-5-fluoro-7-methyl-2,1,3-benzothiadiazole |
| InChIKey | AEURJERKGUIHQF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=NSN=C12)Br)F |
Computed by PubChem (NCBI)