CAS 1427432-37-8 appears in our catalog under these names: 4-bromo-5-fluoro-1,3-benzothiazol-2-amine, 95%, 4-bromo-5-fluoro-1,3-benzothiazol-2-amine, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g.
4-bromo-5-fluoro-1,3-benzothiazol-2-amine (CAS 1427432-37-8) is a chemical compound with the molecular formula C7H4BrFN2S and a molecular weight of 247.09 g/mol. IUPAC name: 4-bromo-5-fluoro-1,3-benzothiazol-2-amine. InChIKey: LZBRUCWOBZQPKI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2S |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 4-bromo-5-fluoro-1,3-benzothiazol-2-amine |
| InChIKey | LZBRUCWOBZQPKI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1F)Br)N=C(S2)N |
Computed by PubChem (NCBI)