Products 2407332-41-4
CAS 2407332-41-4 is the registry number for 5-Bromo-6-fluoro-2-methylthiazolo[4,5-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-6-fluoro-2-methyl-[1,3]thiazolo[4,5-b]pyridine (CAS 2407332-41-4) is a chemical compound with the molecular formula C7H4BrFN2S and a molecular weight of 247.09 g/mol. IUPAC name: 5-bromo-6-fluoro-2-methyl-[1,3]thiazolo[4,5-b]pyridine. InChIKey: OYYBMNRHPSVIDU-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2S |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 5-bromo-6-fluoro-2-methyl-[1,3]thiazolo[4,5-b]pyridine |
| InChIKey | OYYBMNRHPSVIDU-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=C(C(=N2)Br)F |
Computed by PubChem (NCBI)