CAS 1022151-47-8 appears in our catalog under these names: 3-Bromoquinolin-6-yl acetate, 95%, 3-Bromoquinolin-6-yl acetate 95+%, 3-Bromoquinolin-6-yl acetate, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g.
(3-bromoquinolin-6-yl) acetate (CAS 1022151-47-8) is a chemical compound with the molecular formula C11H8BrNO2 and a molecular weight of 266.09 g/mol. IUPAC name: (3-bromoquinolin-6-yl) acetate. InChIKey: ZXPMRDCMTBPCLA-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2 |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | (3-bromoquinolin-6-yl) acetate |
| InChIKey | ZXPMRDCMTBPCLA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=CC(=CN=C2C=C1)Br |
Computed by PubChem (NCBI)