CAS 355829-50-4 appears in our catalog under these names: 5-Bromo-2-cyclopropylisoindoline-1,3-dione, 95%, 5–Bromo–2–cyclopropylisoindoline–1,3–dione, 5-Bromo-2-cyclopropylisoindoline-1,3-dione, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 100mg, 1g.
5-bromo-2-cyclopropylisoindole-1,3-dione (CAS 355829-50-4) is a chemical compound with the molecular formula C11H8BrNO2 and a molecular weight of 266.09 g/mol. IUPAC name: 5-bromo-2-cyclopropylisoindole-1,3-dione. InChIKey: FQZPROOCAFURPX-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2 |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | 5-bromo-2-cyclopropylisoindole-1,3-dione |
| InChIKey | FQZPROOCAFURPX-UHFFFAOYSA-N |
| SMILES | C1CC1N2C(=O)C3=C(C2=O)C=C(C=C3)Br |
Computed by PubChem (NCBI)