Products 1226361-85-8
CAS 1226361-85-8 appears in our catalog under these names: 5-(4-Bromophenyl)-1h-pyrrole-2-carboxylic acid, 95%, 5–(4–Bromophenyl)–1H–pyrrole–2–carboxylic acid, 5-(4-Bromophenyl)-1H-pyrrole-2-carboxylic acid 95%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 100mg, 5g, 1g, 250mg.
5-(4-bromophenyl)-1H-pyrrole-2-carboxylic acid (CAS 1226361-85-8) is a chemical compound with the molecular formula C11H8BrNO2 and a molecular weight of 266.09 g/mol. IUPAC name: 5-(4-bromophenyl)-1H-pyrrole-2-carboxylic acid. InChIKey: XFPCUPCSGIKYSO-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2 |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | 5-(4-bromophenyl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | XFPCUPCSGIKYSO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(N2)C(=O)O)Br |
Computed by PubChem (NCBI)