CAS 1022151-50-3 appears in our catalog under these names: 1-(2H3)Methyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazole, 98%, 1-Methyl-1H-pyrazole-4-boronic acid pinacol ester-d3, 98.0%. Offered by: Combi-blocks, MedChemExpress. Available pack sizes: 250mg, 5g, 1g, 1 g, 5 g, 500 mg, 100 mg, 250 mg.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(trideuteriomethyl)pyrazole (CAS 1022151-50-3) is a chemical compound with the molecular formula C10H17BN2O2 and a molecular weight of 211.09 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(trideuteriomethyl)pyrazole. InChIKey: UCNGGGYMLHAMJG-VPYROQPTSA-N.
| Molecular formula | C10H17BN2O2 |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(trideuteriomethyl)pyrazole |
| InChIKey | UCNGGGYMLHAMJG-VPYROQPTSA-N |
| SMILES | [2H]C([2H])([2H])N1C=C(C=N1)B2OC(C(O2)(C)C)(C)C |
Computed by PubChem (NCBI)