CAS 847818-74-0 appears in our catalog under these names: 1–Methyl–1H–pyrazole–5–boronic acid pinacol ester, 1-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole 97%, 1-METHYL-1H-PYRAZOLE-5-BORONIC ACID PIN&, 1-Methyl-1H-pyrazole-5-boronic acid pinacol ester, 97%, 97%, 1-Methyl-1H-pyrazole-5-boronic acid pinacol ester, 97%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 10g, 100g, 500g, 1000g, 1kg.
1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 847818-74-0) is a chemical compound with the molecular formula C10H17BN2O2 and a molecular weight of 208.07 g/mol. IUPAC name: 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: HLXOVAMYQUFLPE-UHFFFAOYSA-N.
| Molecular formula | C10H17BN2O2 |
|---|---|
| Molecular weight | 208.07 g/mol |
| IUPAC name | 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | HLXOVAMYQUFLPE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NN2C |
Computed by PubChem (NCBI)