CAS 2135512-71-7 is the registry number for 2–methyl–4–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)–1H–imidazole. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole (CAS 2135512-71-7) is a chemical compound with the molecular formula C10H17BN2O2 and a molecular weight of 208.07 g/mol. IUPAC name: 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole. InChIKey: GRGUAFXGRRCERQ-UHFFFAOYSA-N.
| Molecular formula | C10H17BN2O2 |
|---|---|
| Molecular weight | 208.07 g/mol |
| IUPAC name | 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole |
| InChIKey | GRGUAFXGRRCERQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N2)C |
Computed by PubChem (NCBI)