CAS 553651-31-3 appears in our catalog under these names: 1-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-imidazole, 95%, 1-Methyl-1H-imidazole-2-boronic acid pinacolester. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 0,1g, 0,25g, 0,5g.
1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole (CAS 553651-31-3) is a chemical compound with the molecular formula C10H17BN2O2 and a molecular weight of 208.07 g/mol. IUPAC name: 1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole. InChIKey: PUEBUBYUYPLMLU-UHFFFAOYSA-N.
| Molecular formula | C10H17BN2O2 |
|---|---|
| Molecular weight | 208.07 g/mol |
| IUPAC name | 1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole |
| InChIKey | PUEBUBYUYPLMLU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC=CN2C |
Computed by PubChem (NCBI)