CAS 1440520-87-5 appears in our catalog under these names: 4-Methylpyrazole-5-boronic acid, pinacol ester, 4-Methylpyrazole-5-boronic acid pinacol ester, 97%, 4–Methyl–3–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)–1H–pyrazole, 4-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole 98%, 4-Methylpyrazole-5-boronic acid pinacol ester, 98%, 98%. Offered by: Biosynth, Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 0,5g, 250mg, 10g, 1g, 100mg, 25mg, 500mg.
4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (CAS 1440520-87-5) is a chemical compound with the molecular formula C10H17BN2O2 and a molecular weight of 208.07 g/mol. IUPAC name: 4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole. InChIKey: HQYVEZWZGLCNIU-UHFFFAOYSA-N.
| Molecular formula | C10H17BN2O2 |
|---|---|
| Molecular weight | 208.07 g/mol |
| IUPAC name | 4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| InChIKey | HQYVEZWZGLCNIU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NN2)C |
Computed by PubChem (NCBI)