CAS 1022675-06-4 is the registry number for 1-(4-chloro-3-nitrophenyl)-2,6-dimethyl-5,6,7-trihydroindol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
1-(4-chloro-3-nitrophenyl)-2,6-dimethyl-6,7-dihydro-5H-indol-4-one (CAS 1022675-06-4) is a chemical compound with the molecular formula C16H15ClN2O3 and a molecular weight of 318.75 g/mol. IUPAC name: 1-(4-chloro-3-nitrophenyl)-2,6-dimethyl-6,7-dihydro-5H-indol-4-one. InChIKey: VPHXPJWNBNQFPN-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O3 |
|---|---|
| Molecular weight | 318.75 g/mol |
| IUPAC name | 1-(4-chloro-3-nitrophenyl)-2,6-dimethyl-6,7-dihydro-5H-indol-4-one |
| InChIKey | VPHXPJWNBNQFPN-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C=C(N2C3=CC(=C(C=C3)Cl)[N+](=O)[O-])C)C(=O)C1 |
Computed by PubChem (NCBI)