CAS 2682112-64-5 is the registry number for 2-(8-(Benzyloxy)imidazo[1,2-a]pyridin-2-yl)acetic acid hydrochloride 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(8-phenylmethoxyimidazo[1,2-a]pyridin-2-yl)acetic acid;hydrochloride (CAS 2682112-64-5) is a chemical compound with the molecular formula C16H15ClN2O3 and a molecular weight of 318.75 g/mol. IUPAC name: 2-(8-phenylmethoxyimidazo[1,2-a]pyridin-2-yl)acetic acid;hydrochloride. InChIKey: CHMZKPYOHBYPMS-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O3 |
|---|---|
| Molecular weight | 318.75 g/mol |
| IUPAC name | 2-(8-phenylmethoxyimidazo[1,2-a]pyridin-2-yl)acetic acid;hydrochloride |
| InChIKey | CHMZKPYOHBYPMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CN3C2=NC(=C3)CC(=O)O.Cl |
Computed by PubChem (NCBI)