Products 1031208-58-8
CAS 1031208-58-8 is the registry number for 4-(4-chlorophenyl)-4-oxo-2-((3-pyridylmethyl)amino)butanoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
4-(4-chlorophenyl)-4-oxo-2-(pyridin-3-ylmethylamino)butanoic acid (CAS 1031208-58-8) is a chemical compound with the molecular formula C16H15ClN2O3 and a molecular weight of 318.75 g/mol. IUPAC name: 4-(4-chlorophenyl)-4-oxo-2-(pyridin-3-ylmethylamino)butanoic acid. InChIKey: AKJSULODCDBQFB-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O3 |
|---|---|
| Molecular weight | 318.75 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-4-oxo-2-(pyridin-3-ylmethylamino)butanoic acid |
| InChIKey | AKJSULODCDBQFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CNC(CC(=O)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)