CAS 2009208-96-0 appears in our catalog under these names: Clobazam Impurity 4, N-Desmethyl O-Methyl Clobazam. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
Methyl 3-(2-anilino-4-chloroanilino)-3-oxopropanoate (CAS 2009208-96-0) is a chemical compound with the molecular formula C16H15ClN2O3 and a molecular weight of 318.75 g/mol. IUPAC name: methyl 3-(2-anilino-4-chloroanilino)-3-oxopropanoate. InChIKey: UODYCFVUCMOZER-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O3 |
|---|---|
| Molecular weight | 318.75 g/mol |
| IUPAC name | methyl 3-(2-anilino-4-chloroanilino)-3-oxopropanoate |
| InChIKey | UODYCFVUCMOZER-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)NC1=C(C=C(C=C1)Cl)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)