CAS 1197377-31-3 appears in our catalog under these names: 1-(2-Chloro-1-hydroxy-3-(quinolin-6-yl)propyl)pyrrolidine-2,5-dione, 95%, 95%, 1-(2-Chloro-1-hydroxy-3-(quinolin-6-yl)propyl)pyrrolidine-2,5-dione, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(2-chloro-1-hydroxy-3-quinolin-6-ylpropyl)pyrrolidine-2,5-dione (CAS 1197377-31-3) is a chemical compound with the molecular formula C16H15ClN2O3 and a molecular weight of 318.75 g/mol. IUPAC name: 1-(2-chloro-1-hydroxy-3-quinolin-6-ylpropyl)pyrrolidine-2,5-dione. InChIKey: FUPWOFWDARMISK-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O3 |
|---|---|
| Molecular weight | 318.75 g/mol |
| IUPAC name | 1-(2-chloro-1-hydroxy-3-quinolin-6-ylpropyl)pyrrolidine-2,5-dione |
| InChIKey | FUPWOFWDARMISK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)C(C(CC2=CC3=C(C=C2)N=CC=C3)Cl)O |
Computed by PubChem (NCBI)