CAS 1022714-94-8 is the registry number for 2-(4-bromophenyl)-6,6-dimethyl-5,6,7-trihydrooxainden-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzofuran-4-one (CAS 1022714-94-8) is a chemical compound with the molecular formula C16H15BrO2 and a molecular weight of 319.19 g/mol. IUPAC name: 2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzofuran-4-one. InChIKey: YOTJNIQBTYSXPH-UHFFFAOYSA-N.
| Molecular formula | C16H15BrO2 |
|---|---|
| Molecular weight | 319.19 g/mol |
| IUPAC name | 2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzofuran-4-one |
| InChIKey | YOTJNIQBTYSXPH-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C=C(O2)C3=CC=C(C=C3)Br)C(=O)C1)C |
Computed by PubChem (NCBI)