CAS 1183611-53-1 is the registry number for 1-(2-Bromo-4-methoxyphenyl)-2-(2-methylphenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2-bromo-4-methoxyphenyl)-2-(2-methylphenyl)ethanone (CAS 1183611-53-1) is a chemical compound with the molecular formula C16H15BrO2 and a molecular weight of 319.19 g/mol. IUPAC name: 1-(2-bromo-4-methoxyphenyl)-2-(2-methylphenyl)ethanone. InChIKey: DTIONHNFXSQRNX-UHFFFAOYSA-N.
| Molecular formula | C16H15BrO2 |
|---|---|
| Molecular weight | 319.19 g/mol |
| IUPAC name | 1-(2-bromo-4-methoxyphenyl)-2-(2-methylphenyl)ethanone |
| InChIKey | DTIONHNFXSQRNX-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1CC(=O)C2=C(C=C(C=C2)OC)Br |
Computed by PubChem (NCBI)