CAS 1022972-01-5 is the registry number for 8-Amino-2,3,4,5-tetrahydro-1H-2-benzazepin-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
8-amino-2,3,4,5-tetrahydro-2-benzazepin-1-one (CAS 1022972-01-5) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 8-amino-2,3,4,5-tetrahydro-2-benzazepin-1-one. InChIKey: GTNSBFKKRPRPKU-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 8-amino-2,3,4,5-tetrahydro-2-benzazepin-1-one |
| InChIKey | GTNSBFKKRPRPKU-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)N)C(=O)NC1 |
Computed by PubChem (NCBI)