CAS 10230-79-2 is the registry number for Eletriptan Impurity 7. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(E)-2-chloroethenyl]sulfonylbenzene (CAS 10230-79-2) is a chemical compound with the molecular formula C8H7ClO2S and a molecular weight of 202.66 g/mol. IUPAC name: [(E)-2-chloroethenyl]sulfonylbenzene. InChIKey: VIWJASZMKWEDNV-VOTSOKGWSA-N.
| Molecular formula | C8H7ClO2S |
|---|---|
| Molecular weight | 202.66 g/mol |
| IUPAC name | [(E)-2-chloroethenyl]sulfonylbenzene |
| InChIKey | VIWJASZMKWEDNV-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)/C=C/Cl |
Computed by PubChem (NCBI)