Products 1023479-67-5
CAS 1023479-67-5 is the registry number for 2-nitro-3-((3-(trifluoromethyl)phenyl)amino)cyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
2-nitro-3-[3-(trifluoromethyl)anilino]cyclohex-2-en-1-one (CAS 1023479-67-5) is a chemical compound with the molecular formula C13H11F3N2O3 and a molecular weight of 300.23 g/mol. IUPAC name: 2-nitro-3-[3-(trifluoromethyl)anilino]cyclohex-2-en-1-one. InChIKey: RHZBVROWKMYKOK-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O3 |
|---|---|
| Molecular weight | 300.23 g/mol |
| IUPAC name | 2-nitro-3-[3-(trifluoromethyl)anilino]cyclohex-2-en-1-one |
| InChIKey | RHZBVROWKMYKOK-UHFFFAOYSA-N |
| SMILES | C1CC(=C(C(=O)C1)[N+](=O)[O-])NC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)