CAS 1023524-34-6 is the registry number for 3-(tert-butyl)-1-(4-chlorobutanoyl)indeno(2,3-d)pyrazol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-tert-butyl-1-(4-chlorobutanoyl)indeno[2,1-d]pyrazol-4-one (CAS 1023524-34-6) is a chemical compound with the molecular formula C18H19ClN2O2 and a molecular weight of 330.8 g/mol. IUPAC name: 3-tert-butyl-1-(4-chlorobutanoyl)indeno[2,1-d]pyrazol-4-one. InChIKey: ZIBZOCZPQGGPLQ-UHFFFAOYSA-N.
| Molecular formula | C18H19ClN2O2 |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | 3-tert-butyl-1-(4-chlorobutanoyl)indeno[2,1-d]pyrazol-4-one |
| InChIKey | ZIBZOCZPQGGPLQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C2=C1C(=O)C3=CC=CC=C32)C(=O)CCCCl |
Computed by PubChem (NCBI)