CAS 1269151-97-4 appears in our catalog under these names: N-(3-[1-(2-Chloro-n-methylacetamido)ethyl]phenyl)benzamide, 95%, N-{3-(1-(2-chloro-N-methylacetamido)ethyl)phenyl}benzamide, 95%, N-{3-(1-(2-Chloro-N-methylacetamido)ethyl)phenyl}benzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
N-[3-[1-[(2-chloroacetyl)-methylamino]ethyl]phenyl]benzamide (CAS 1269151-97-4) is a chemical compound with the molecular formula C18H19ClN2O2 and a molecular weight of 330.8 g/mol. IUPAC name: N-[3-[1-[(2-chloroacetyl)-methylamino]ethyl]phenyl]benzamide. InChIKey: FILFCVOZDJMQEX-UHFFFAOYSA-N.
| Molecular formula | C18H19ClN2O2 |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | N-[3-[1-[(2-chloroacetyl)-methylamino]ethyl]phenyl]benzamide |
| InChIKey | FILFCVOZDJMQEX-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)NC(=O)C2=CC=CC=C2)N(C)C(=O)CCl |
Computed by PubChem (NCBI)