CAS 22839-16-3 appears in our catalog under these names: D–Tryptophan Benzyl Ester Hydrochloride, D-Tryptophan Benzyl Ester Hydrochloride, >98.0%(N)(HPLC), H-D-Trp-OBzl.HCl, 97%, 97%, H-D-Trp-OBzl·HCl 97%, H-D-Trp-OBzl·HCl, 97%. Offered by: GLPBio, TCI, Chemat, Ambeed. Available pack sizes: 25g, 5g, 1g, 100g, 10g.
Benzyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride (CAS 22839-16-3) is a chemical compound with the molecular formula C18H19ClN2O2 and a molecular weight of 330.8 g/mol. IUPAC name: benzyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride. InChIKey: DOKDMGOWZOTZRA-PKLMIRHRSA-N.
| Molecular formula | C18H19ClN2O2 |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | benzyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | DOKDMGOWZOTZRA-PKLMIRHRSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@@H](CC2=CNC3=CC=CC=C32)N.Cl |
Computed by PubChem (NCBI)