CAS 35858-81-2 appears in our catalog under these names: L-Tryptophan Benzyl Ester Hydrochloride, H–Trp–OBzl·HCl, H-Trp-OBzl·HCl 97%, H-Trp-OBzl.HCl, 97%, 97%, Trp-O-Bz (hydrochloride), 99.89%. Offered by: TRC, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 100g, 25g, 1g, 10g, 500g, 25 g, 5 g.
Benzyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride (CAS 35858-81-2) is a chemical compound with the molecular formula C18H19ClN2O2 and a molecular weight of 330.8 g/mol. IUPAC name: benzyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride. InChIKey: DOKDMGOWZOTZRA-NTISSMGPSA-N.
| Molecular formula | C18H19ClN2O2 |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | DOKDMGOWZOTZRA-NTISSMGPSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CC2=CNC3=CC=CC=C32)N.Cl |
Computed by PubChem (NCBI)