CAS 1432725-24-0 appears in our catalog under these names: Tolvaptan Impurity 6, Tolvaptan Impurity 4, 2-Desmethylbenzaldehyde Tolvaptan, >95% (HPLC), 2-Desmethylbenzaldehyde tolvaptan. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg.
(4-amino-2-methylphenyl)-(7-chloro-5-hydroxy-2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone (CAS 1432725-24-0) is a chemical compound with the molecular formula C18H19ClN2O2 and a molecular weight of 330.8 g/mol. IUPAC name: (4-amino-2-methylphenyl)-(7-chloro-5-hydroxy-2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone. InChIKey: XVFPODYXXNMTEB-UHFFFAOYSA-N.
| Molecular formula | C18H19ClN2O2 |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | (4-amino-2-methylphenyl)-(7-chloro-5-hydroxy-2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone |
| InChIKey | XVFPODYXXNMTEB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)C(=O)N2CCCC(C3=C2C=CC(=C3)Cl)O |
Computed by PubChem (NCBI)