Products 1023875-60-6
CAS 1023875-60-6 is the registry number for 4-(2,2-dimethyl(3-oxaindan-4-yloxy))-1-nitrobenzene. Offered by: Biosynth. Available pack sizes: 250mg.
2,2-dimethyl-7-(4-nitrophenoxy)-3H-1-benzofuran (CAS 1023875-60-6) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: 2,2-dimethyl-7-(4-nitrophenoxy)-3H-1-benzofuran. InChIKey: IZKKSDBAJLZDOU-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 2,2-dimethyl-7-(4-nitrophenoxy)-3H-1-benzofuran |
| InChIKey | IZKKSDBAJLZDOU-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C(=CC=C2)OC3=CC=C(C=C3)[N+](=O)[O-])C |
Computed by PubChem (NCBI)