Products 102419-91-0
CAS 102419-91-0 is the registry number for (R)-N-Deacetyl Colchicine. Offered by: TRC. Available pack sizes: 100mg.
(7R)-7-amino-1,2,3,10-tetramethoxy-6,7-dihydro-5H-benzo[a]heptalen-9-one (CAS 102419-91-0) is a chemical compound with the molecular formula C20H23NO5 and a molecular weight of 357.4 g/mol. IUPAC name: (7R)-7-amino-1,2,3,10-tetramethoxy-6,7-dihydro-5H-benzo[a]heptalen-9-one. InChIKey: HFPMXDMZJUJZBX-CQSZACIVSA-N.
| Molecular formula | C20H23NO5 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (7R)-7-amino-1,2,3,10-tetramethoxy-6,7-dihydro-5H-benzo[a]heptalen-9-one |
| InChIKey | HFPMXDMZJUJZBX-CQSZACIVSA-N |
| SMILES | COC1=CC=C2C(=CC1=O)[C@@H](CCC3=CC(=C(C(=C32)OC)OC)OC)N |
Computed by PubChem (NCBI)