Products 1024248-28-9
CAS 1024248-28-9 is the registry number for 2,6-dimethyl-1-(3-methyl-4-nitrophenyl)-5,6,7-trihydroindol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
2,6-dimethyl-1-(3-methyl-4-nitrophenyl)-6,7-dihydro-5H-indol-4-one (CAS 1024248-28-9) is a chemical compound with the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. IUPAC name: 2,6-dimethyl-1-(3-methyl-4-nitrophenyl)-6,7-dihydro-5H-indol-4-one. InChIKey: DCYKYFBUZXGQKJ-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O3 |
|---|---|
| Molecular weight | 298.34 g/mol |
| IUPAC name | 2,6-dimethyl-1-(3-methyl-4-nitrophenyl)-6,7-dihydro-5H-indol-4-one |
| InChIKey | DCYKYFBUZXGQKJ-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C=C(N2C3=CC(=C(C=C3)[N+](=O)[O-])C)C)C(=O)C1 |
Computed by PubChem (NCBI)