Products 1024383-06-9
CAS 1024383-06-9 is the registry number for 3-benzo(d)1,3-dioxolen-5-yl-1,6,6-trimethyl-5,6,7-trihydro1H-indazol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-(1,3-benzodioxol-5-yl)-1,6,6-trimethyl-5,7-dihydroindazol-4-one (CAS 1024383-06-9) is a chemical compound with the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-yl)-1,6,6-trimethyl-5,7-dihydroindazol-4-one. InChIKey: JJRPTXVPSZXWSI-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O3 |
|---|---|
| Molecular weight | 298.34 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-yl)-1,6,6-trimethyl-5,7-dihydroindazol-4-one |
| InChIKey | JJRPTXVPSZXWSI-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(=O)C1)C(=NN2C)C3=CC4=C(C=C3)OCO4)C |
Computed by PubChem (NCBI)