Products 1024742-76-4
CAS 1024742-76-4 is the registry number for ethyl 3-((4-ethoxyphenyl)amino)-2-((4-methylphenyl)sulfonyl)prop-2-enoate. Offered by: Biosynth. Available pack sizes: 250mg.
Ethyl (E)-3-(4-ethoxyanilino)-2-(4-methylphenyl)sulfonylprop-2-enoate (CAS 1024742-76-4) is a chemical compound with the molecular formula C20H23NO5S and a molecular weight of 389.5 g/mol. IUPAC name: ethyl (E)-3-(4-ethoxyanilino)-2-(4-methylphenyl)sulfonylprop-2-enoate. InChIKey: QPXQEYOKLCKESZ-XMHGGMMESA-N.
| Molecular formula | C20H23NO5S |
|---|---|
| Molecular weight | 389.5 g/mol |
| IUPAC name | ethyl (E)-3-(4-ethoxyanilino)-2-(4-methylphenyl)sulfonylprop-2-enoate |
| InChIKey | QPXQEYOKLCKESZ-XMHGGMMESA-N |
| SMILES | CCOC1=CC=C(C=C1)N/C=C(\C(=O)OCC)/S(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)