Products 2884551-59-9
CAS 2884551-59-9 is the registry number for 1-Formyl-N,N-bis(4-methoxybenzyl)cyclopropane-1-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-formyl-N,N-bis[(4-methoxyphenyl)methyl]cyclopropane-1-sulfonamide (CAS 2884551-59-9) is a chemical compound with the molecular formula C20H23NO5S and a molecular weight of 389.5 g/mol. IUPAC name: 1-formyl-N,N-bis[(4-methoxyphenyl)methyl]cyclopropane-1-sulfonamide. InChIKey: WQGDVMDLOISYNL-UHFFFAOYSA-N.
| Molecular formula | C20H23NO5S |
|---|---|
| Molecular weight | 389.5 g/mol |
| IUPAC name | 1-formyl-N,N-bis[(4-methoxyphenyl)methyl]cyclopropane-1-sulfonamide |
| InChIKey | WQGDVMDLOISYNL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN(CC2=CC=C(C=C2)OC)S(=O)(=O)C3(CC3)C=O |
Computed by PubChem (NCBI)