CAS 885269-48-7 appears in our catalog under these names: 1-(4'-Methoxy-4-biphenylylsulfonylamino)cyclohexanecarboxylic acid, 95%, 1–((4'–Methoxy–(1,1'–biphenyl))–4–sulfonamido)cyclohexane–1–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]cyclohexane-1-carboxylic acid (CAS 885269-48-7) is a chemical compound with the molecular formula C20H23NO5S and a molecular weight of 389.5 g/mol. IUPAC name: 1-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]cyclohexane-1-carboxylic acid. InChIKey: JAKSOMBIPMPTDM-UHFFFAOYSA-N.
| Molecular formula | C20H23NO5S |
|---|---|
| Molecular weight | 389.5 g/mol |
| IUPAC name | 1-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | JAKSOMBIPMPTDM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)S(=O)(=O)NC3(CCCCC3)C(=O)O |
Computed by PubChem (NCBI)