Products 196601-12-4

CAS 196601-12-4 is the registry number for Benzyl 4–(tosyloxy)piperidine–1–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Benzyl 4-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate (CAS 196601-12-4) is a chemical compound with the molecular formula C20H23NO5S and a molecular weight of 389.5 g/mol. IUPAC name: benzyl 4-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate. InChIKey: QTGVXQVMKCJZTR-UHFFFAOYSA-N.

Identity
Molecular formulaC20H23NO5S
Molecular weight389.5 g/mol
IUPAC namebenzyl 4-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate
InChIKeyQTGVXQVMKCJZTR-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OC2CCN(CC2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)