CAS 1214994-13-4 is the registry number for (S)-Indeloxazine (benzenesulfonate). Offered by: MedChemExpress. Available pack sizes: Get quote.
Benzenesulfonic acid;(2S)-2-(3H-inden-4-yloxymethyl)morpholine (CAS 1214994-13-4) is a chemical compound with the molecular formula C20H23NO5S and a molecular weight of 389.5 g/mol. IUPAC name: benzenesulfonic acid;(2S)-2-(3H-inden-4-yloxymethyl)morpholine. InChIKey: HLSBLOLRAXOIFW-YDALLXLXSA-N.
| Molecular formula | C20H23NO5S |
|---|---|
| Molecular weight | 389.5 g/mol |
| IUPAC name | benzenesulfonic acid;(2S)-2-(3H-inden-4-yloxymethyl)morpholine |
| InChIKey | HLSBLOLRAXOIFW-YDALLXLXSA-N |
| SMILES | C1CO[C@@H](CN1)COC2=CC=CC3=C2CC=C3.C1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)