Products 1025085-36-2

CAS 1025085-36-2 is the registry number for Rosuvastatin D-5 Diastereomer Impurity. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 2-[6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 1025085-36-2) is a chemical compound with the molecular formula C15H26O6 and a molecular weight of 302.36 g/mol. IUPAC name: tert-butyl 2-[6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: NGABCYSYENPREI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26O6
Molecular weight302.36 g/mol
IUPAC nametert-butyl 2-[6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate
InChIKeyNGABCYSYENPREI-UHFFFAOYSA-N
SMILESCC(=O)OCC1CC(OC(O1)(C)C)CC(=O)OC(C)(C)C

Computed by PubChem (NCBI)