CAS 888010-02-4 appears in our catalog under these names: Propargyl-peg4-ch2co2tbu, 95%, Propargyl–PEG3–OCH2–Boc, Propargyl-peg4-ch2co2tbu, 98%, 98%, Propargyl-PEG3-OCH2-Boc, Propargyl-PEG3-OCH2-Boc, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg, 5 mg, 100 mg, 50 mg, 10 mg.
Tert-butyl 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]acetate (CAS 888010-02-4) is a chemical compound with the molecular formula C15H26O6 and a molecular weight of 302.36 g/mol. IUPAC name: tert-butyl 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]acetate. InChIKey: YWUOCZSOXBPJMP-UHFFFAOYSA-N.
| Molecular formula | C15H26O6 |
|---|---|
| Molecular weight | 302.36 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]acetate |
| InChIKey | YWUOCZSOXBPJMP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCC#C |
Computed by PubChem (NCBI)