CAS 1642330-94-6 appears in our catalog under these names: Rosuvastatin Impurity 73, Rosuvastatin Impurity 17, Rosuvastatin Impurity 31. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Tert-butyl 2-[(4S,6S)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 1642330-94-6) is a chemical compound with the molecular formula C15H26O6 and a molecular weight of 302.36 g/mol. IUPAC name: tert-butyl 2-[(4S,6S)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: NGABCYSYENPREI-RYUDHWBXSA-N.
| Molecular formula | C15H26O6 |
|---|---|
| Molecular weight | 302.36 g/mol |
| IUPAC name | tert-butyl 2-[(4S,6S)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | NGABCYSYENPREI-RYUDHWBXSA-N |
| SMILES | CC(=O)OC[C@@H]1C[C@H](OC(O1)(C)C)CC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)