CAS 2375865-91-9 appears in our catalog under these names: Rosuvastatin Impurity 74 (Rosuvastatin D-5 Enatiomer Impurity), Rosuvastatin Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-[(4S,6R)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 2375865-91-9) is a chemical compound with the molecular formula C15H26O6 and a molecular weight of 302.36 g/mol. IUPAC name: tert-butyl 2-[(4S,6R)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: NGABCYSYENPREI-NWDGAFQWSA-N.
| Molecular formula | C15H26O6 |
|---|---|
| Molecular weight | 302.36 g/mol |
| IUPAC name | tert-butyl 2-[(4S,6R)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | NGABCYSYENPREI-NWDGAFQWSA-N |
| SMILES | CC(=O)OC[C@H]1C[C@H](OC(O1)(C)C)CC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)